Good morning!
The correct formula for potassium nitrite is KNO2.
Hugs!
Answer:
animal cell
Explanation:
Cytokinesis -
It refers to the process of cell division, which takes place during mitosis, is known as cytokinesis.
The process of cytokinesis is different for animal cell and plant cell.
- Where, in case of plant cell, a separation, known as cell plate is formed along the center of the parent cell, which is responsible for the separation of the cells.
- Whereas, in case of animal cell, the plasma membrane contracts itself along the center, until the two daughter cells are separated from each other.
Hence, from the given information of the question,
The correct answer is animal cell.
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
Answer: Option (b) is the correct answer.
Explanation:
When there are more number of hydroxide ions in a solution then there will be high concentration of 
or hydroxide ions. As a result, more will be the strength of base in that particular solution.
A base is strong when it readily dissociate into its ions in the solution. When a base is strong, then it does not matter at what concentration it is dissolved in the solution because despite of its low concentration it will remain a strong base.
Thus, we can conclude that out of the given options, the statement even at low concentrations, a strong base is strong best relates the strength and concentration of a base.
molar mass = (22.99) + (1.01) + (12.01) + 3(16.00)
molar mass = 84.01 g/mol
//
(508g)(1 mol/84.01 g) = 6.0
There are 6.0 moles of sodium bicarbonate
