Answer:
here
Explanation:
0.000141 to kilowatt-hours. hope this helped
Answer:
The answer to the question is
The specific heat capacity of the alloy = 1.77 J/(g·°C)
Explanation:
To solve this, we list out the given variables thus
Mass of alloy = 45 g
Initial temperature of the alloy = 25 °C
Final temperature of the alloy = 37 °C
Heat absorbed by the alloy = 956 J
Thus we have
ΔH = m·c·(T₂ - T₁) where ΔH = heat absorbed by the alloy = 956 J, c = specific heat capacity of the alloy and T₁ = Initial temperature of the alloy = 25 °C , T₂ = Final temperature of the alloy = 37 °C and m = mass of the alloy = 45 g
∴ 956 J = 45 × C × (37 - 25) = 540 g·°C×c or
c = 956 J/(540 g·°C) = 1.77 J/(g·°C)
The specific heat capacity of the alloy is 1.77 J/(g·°C)
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
Continental air masses are characterized by dry air near the surface while maritime air masses are moist .Polar air masses are characterized by cold air near the surface while tropical air masses are warm or hot. Arctic air masses are extremely cold.
:::::::)
The outer core of the Earth is a fluid layer about 2,300 km (1,400 mi) thick and composed of mostly iron<span> and</span>nickel<span> that lies above Earth's solid inner core and below its mantle. Its outer boundary lies 2,890 km (1,800 mi) beneath Earth's surface.</span>
