Secondary consumers in a food web are carnivores that feed on primary consumers. Consumers are organisms that receive energy by eating other organisms. Specifically, primary consumers are those that feed on producers. Producers are those that are able to produce their own food, like plants. Meanwhile, secondary consumers, like humans, eat primary consumers such as cows.
Answer:
3. An oxygen atom with 8 electrons, 8 protons, and 9 neutrons .
Explanation:
if an atom contains equal numbers of protons and electrons, the atom is described as being neutral.
1) is the answer because the only way to turn it from blue to yellow is to mix it with an acidic solution.
The quantity is 1 mole of neon
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.