2NH₂ + O₂ → N₂ + 2H₂O
<u>Explanation:</u>
Balancing the equation means, the number of atoms on both sides of the equation must be the same.
In the case of the given equation, we have to find out whether it is balanced or not.
2NH₂ + O₂ → N₂ + 2H₂O
Atoms Number of atoms before balancing after balancing
LHS RHS LHS RHS
N 1 2 2 2
H 2 2 4 4
O 2 1 2 2
To balance the N atoms, we have to put 2 in front of NH₂, and then to balance the H, O atoms, we have to put 2 in front of H₂O, so that each atom in left hand as well as right hand side of the equation was balanced.
This question includes four answer choices:
A. definite volume, highest molecular motion, highest kinetic energy
B. indefinite volume, least molecular motion, highest kinetic energy
C. definite volume, least molecular motion, lowest kinetic energy
D. definite volume, no molecular motion, lowest kinetic energy
Solids do not have the highest molecular motion (on the contrary they have the least molecular motion), so you can discard option A. Solids have a definite volume and the highest kinetic energy (given that they have the least molecular motion), so you discard option C. Molecules always have a vibrational motion, so you discard option D. Option C, have only characteristics that correctly describes a solid: definite volume, least molecular motion, lowest kinetic energy. Therefore, the answer is the option C.
<span /><span>
</span>
Explanation:
dredge to do with me to do with me to do with me to do with me to do with me to
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
