An electron is a negatively charged subatomic particle present in the space outside the nucleus of an atom. The loss of electron from an atom results in the formation of cation whereas gaining of electron by an atom results in the formation of anion. The cation possesses positive charge due to loss of electron and anion possesses negative charge due to gain of electron.
The neutral atom has no charge on it.
For given atomic symbols:
The atomic number of hydrogen is 1 and the given symbol has no charge that means it is in its neutral state. So, the number of electrons in 
is 1.
The atomic number of helium is 2 and the given symbol has no charge that means it is in its neutral state. So, the number of electrons in 
is 2.
The atomic number of hydrogen is 1 and the given symbol has a negative charge that represents a gain of electron. So, the number of electrons in 
is 2.
The atomic number of helium is 2 and the given symbol has two positive charge that represents loss of two electrons. So, the number of electrons in 
is 0.
Hence, has no electrons.
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Answer:
Reactants
Explanation:
"Starting chemicals", the substances present before a reaction occurs, are called reactants.
The results of the reaction are called products, which you would also have 15.0g.
Answer:
b. octadecanoic acid
Explanation:
For explanation please see the attached file.
C. reducing the amount of garbage
Explanation:
The biggest long-term benefit of building a city's recycling building is that it helps to reduce that amount of garbage.
Recycling is simply the collection and processing of waste materials into new products that can be used again.
- Waste recycling helps to reduce that actual proportion and percentage of materials to be considered waste.
- The overall long term goal of any recycling procedure is to reduce the amount of garbage in the environment.
learn more:
Untreated wastes brainly.com/question/4080706
#learnwithBrainly
