According to Gases law, we know,
PV/T = Constant
So, P₁V₁/T₁ = P₂V₂/T₂
Here, P₁ = 108 kPa
V₁ = 592.2 mL
T₁ = 10+273 = 283 K
P₂ = ?
V₂ = 750 mL
T₂ = 28.9+273 = 301.9
Substitute their values,
108 * 592.2 / 283 = P₂ * 750 / 301.9
P₂ = 63957.6 * 301.9 / 283 * 750
P₂ = 19308799.44 / 212250
P₂ = 90.97 kPa
In short, Your Final Answer would be: 90.97 kPa
Hope this helps!
Im pretty sure th answer is D: temp differences on earth surface
Answer:
The boundary would be a divergent boundary
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer:
Explanation:
When you are in the laboratory and take a direct sniff of the chemicals you are using, you run the risk of damaging your mucous membranes or your lungs. When it is necessary to smell chemicals in the lab, the proper technique is to cup your hand above the container and waft the air toward your face.
