Mole is mass (g) / Molar mass (mole/gram)
So to find mass in gram multiply the no.mole by Molar mass
First, we have to get how many grams of C & H & O in the compound:
- the mass of C on CO2 = mass of CO2*molar mass of C /molar mass of CO2
= 0.5213 * 12 / 44 = 0.142 g
- the mass of H atom on H2O = mass of H2O*molar mass of H / molar mass of H2O
=0.2835 * 2 / 18 = 0.0315 g
- the mass of O = the total mass - the mass of C atom - the mass of H atom
= 0.3 - 0.142 - 0.0315 = 0.1265 g
Convert the mass to mole by divided by molar mass
C(0.142/12) H(0.0315/2) O(0.1265/16)
C(0.0118) H(0.01575) O(0.0079) by dividing by the smallest value 0.0079
C1.504 H3.99 O1 by rounding to the nearst fraction
C3/2 H4/1 )1/1 multiply by 2
∴ the emprical formula C3H8O2
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
Answer:
It is reactive because it has to gain an electron to have a full outermost energy level.
Explanation:
The electron configuration of oxygen is 1s2,2s2 2p4.
Oxygen is in group six in the periodic table so it has six electrons in its valence shell. This means that it needs to gain two electrons to obey the octet rule and have a full outer shell of electrons (eight).
