Answer:
Because it can cause health problems or injuries to our sense organs.
Explanation:
Chemicals in the laboratory are made up of different constituents, which may be dangerous or injurious to health. This is the reason why safety measures or precautions have to be taken when working in the laboratory. One of those safety measures is that "one should never use taste, touch, or smell to identify an unknown chemical".
This is so because a chemical that is unknown amounts to the fact that what such chemical contains is unknown, hence, the chemical might have the ability to cause harm or injuries to the sense organ. For example, a conc. acid that is tasted will burn the tongue etc.
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Chris is correct because the reactants and products do not have to have the same mass, but they do have to weigh the same. Is the correct answer:) Hannah is right because the mass of the reactants was different than the mass of the products. is incorrect
Answer
D
Explanation
<em>the</em><em> </em><em>answer</em><em> </em><em>is</em><em> </em><em>D</em>
There are 8 atoms in 2Ca(CIO2)2
