All categories

3 years ago

What are two ways in which minerals can form from a solution?

Chemistry

2 answers:

inn [45]3 years ago

6 0

They could react to form an insoluble precipitate, or they could come out of solution as the solvent evaporates.

Liono4ka [1.6K]3 years ago

3 0

Heat i think is one e wrongbut i could b

You might be interested in

99% of matter that makes up living organisms consists of how many elements?

DiKsa [7]

Answer:

h2o or air

Explanation:

6 0

3 years ago

If 0.55 g of a gas dissolved in 1.0 l of water at 20.0 kpa of pressure, how much will dissolve at 110.0 kPa of pressure?

GaryK [48]

Answer:sup

Explanation:

4 0

3 years ago

How many grams of methionine (MW = 149.21) are needed to make 20 mL of a 150 mM solution?

Leni [432]

Answer:

0.45 g

Explanation:

Step 1: Given data

Molar mass of methionine (M): 149.21 g/mol

Volume of the solution (V): 20 mL

Concentration of the solution (C): 150 mM

Step 2: Calculate the moles of methionine (n)

We will use the following expression.

n = C × V

n = 150 × 10⁻³ mol/L × 20 × 10⁻³ L

n = 3.0 × 10⁻³ mol

Step 3: Calculate the mass of methionine (m)

We will use the following expression.

m = n × M

m = 3.0 × 10⁻³ mol × 149.21 g/mol

m = 0.45 g

7 0

3 years ago

Draw the alcohol that is the product of the reduction of 3-methylpentanal.

natali 33 [55]

Answer: The product from the reduction reaction is

CH3-CH2-CH(CH3)-CH2-CH2OH

IUPAC name; 3- Methylpentan-1-ol

Explanation:

Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.

Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal

CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;

3-methylpenta-1-ol .

The structure of the product is:

CH3-CH2-CH(CH3)-CH2-CH2OH

7 0

3 years ago

How many molecules are contained in 103.4g of sulfuric acid?

Ierofanga [76]

<h3>Answer:</h3>

1.827 × 10²⁴ molecules H₂S

<h3>General Formulas and Concepts:</h3>

<u>Math</u>

<u>Pre-Algebra</u>

Order of Operations: BPEMDAS

Brackets
Parenthesis
Exponents
Multiplication
Division
Addition
Subtraction

Left to Right

<u>Chemistry</u>

<u>Compounds</u>

Writing Compounds
Acids/Bases

<u>Atomic Structure</u>

Reading a Periodic Table
Using Dimensional Analysis
Avogadro's Number - 6.022 × 10²³ atoms, molecules, formula units, etc.

<h3>Explanation:</h3>

<u>Step 1: Define</u>

103.4 g H₂S (Sulfuric Acid)

<u>Step 2: Identify Conversions</u>

Avogadro's Number

Molar Mass of H - 1.01 g/mol

Molar Mass of S - 32.07 g/mol

Molar Mass of H₂S - 2(1.01) + 32.07 = 34.09 g/mol

<u>Step 3: Convert</u>

Set up: $\displaystyle 103.4 \ g \ H_2S(\frac{1 \ mol \ H_2S}{34.09 \ g \ H_2S})(\frac{6.022 \cdot 10^{23} \ molecules \ H_2S}{1 \ mol \ H_2S})$
Multiply: $\displaystyle 1.82656 \cdot 10^{24} \ molecules \ H_2S$

<u>Step 4: Check</u>

<em>Follow sig fig rules and round. We are given 4 sig figs.</em>

1.82656 × 10²⁴ molecules H₂S ≈ 1.827 × 10²⁴ molecules H₂S

4 0

3 years ago