Answer:
Explanation:
2. a [CO3 2-][H3O+] / [H2O][HCO3-
b. [H2PO4-][H3O+]/[H3PO4][H2O]
Answer:
No
Explanation:
Napthalene cannot conduct electricity
Answer:
NH3 is polar due to the bonds between nitrogen and hydrogen which have different electronegativity and due also to its asymmetrical shape.
Explanation:
NH3 is polar as there are 3 dipoles in the ammonia molecule that do not balance each other out.
Considering the N-H bond which is polar because N with an electronegativy of 3.0, is more electronegative than H, with an electronegativity of 2.1. The is overall asymmetrical shape of NH3
means that the dipoles remains unbalanced and do cancel out each other making the NH3 polar.
The number of moles of oxygen required to generate 28 moles of water from the reaction is 14 moles
<h3>Balanced equation </h3>
2H₂ + O₂ —> 2H₂O
From the balanced equation above,
2 moles of water were obtained from 1 mole of oxygen
<h3>How to determine the mole of oxygen needed </h3>
From the balanced equation above,
2 moles of water were obtained from 1 mole of oxygen
Therefore,
28 moles of water will be obtained from = 28 / 2 = 14 moles of oxygen
Thus, 14 moles of oxygen are needed for the reaction
Learn more about stoichiometry:
brainly.com/question/14735801
A Cell with few energy needs would most likely contain a small number of Mitochondria.
- All cells require energy to function, but cells typically have significant energy needs that can only be met by the mitochondria, the cell's powerhouse.
- They transform glucose into ATP, a chemical with a huge energy storage capacity.
- Muscles have a large number of mitochondria, allowing them to react rapidly and powerfully to the body's ongoing need for energy.
- Macromolecules, defunct cell components, and microbes are all digested by lysosomes.
- Vacuoles are typically tiny and aid in the sequestration of waste.
- The ribosome, an intercellular structure consisting of both RNA and protein, is where a cell produces new proteins.
Therefore out of all these cell organelles, the cell has fewer mitochondria for less energy need.
Learn more about cell organelles here:
brainly.com/question/13408297
#SPJ9
