Answer:
Deficiency of calcium which means that her body will take calcium from her bones which results in weakening of bones. (osteoporosis)
Explanation:
Answer:
A Bronsted-Lowry acid like and Arrhenius acid is a compound that breaks down to give an H+ in solution. The only difference is that the solution does not have to be water. ... An Arrhenius base is a molecule that when dissolved in water will break down to yield an OH- or hydroxide in solution.
Explanation:
You should be checking your gas appliances every year, it should always be a qualified technician.
Increases the volume of water
Explanation:
Freezing of water causes the volume of water to increase by a whooping 4%. This is why the density of water is slightly different that of ice.
When ice freezes it expands and takes up more volume of space for the same mass given.
This is why bottles break when water in them is frozen.
This increase in volume is why ice floats on water. It makes it less dense.
learn more:
Density brainly.com/question/3764212
#learnwithBrainly
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH