All categories

3 years ago

Movement of electrons about a central nucleus is a concept by whom?

Chemistry

2 answers:

Burka [1]3 years ago

7 0

Answer:

Bohr.

Explanation:

In 1913, N.Bohr proposed an atomic model for atom. He proposed that in an atom there is a central nucleus and electrons move around this center in a fixed path known as shell.

The shells or path have a fixed size and energy. The electrons do not lose energy during this movement.

There is possibility of energy change (emit or absorb) in an electron if they move from one shell to another.

Alenkasestr [34]3 years ago

5 0

The answer is bohr hope this helps :)

You might be interested in

Part

Zielflug [23.3K]

NaOH (aq) + HCl(aq) => NaCl(aq)+ H2O(l)

Na+(aq)+ OH - (aq) + H +(aq) +Cl - (aq) + Cl- (aq)
=> Na+(aq) + Cl - (aq) + H2O(l)
H+(aq) + OH-(aq) => H2O(l)

6 0

3 years ago

If the mass of a certain block is 500g, what is the weight of the block?

Dafna11 [192]

______________________________

Solution,

Mass=500g =500/1000=0.5 kg

gravity(g)=9.8m/s^2

Now,

Weight= m*g

 = 0.5*9.8

 =4.9 N

So the weight of the block is 4.9 Newton

hope it helps...

Good luck on your assignment

5 0

3 years ago

What type of tectonic activity occurs in the San Andreas Fault?

kykrilka [37]

The answer is a strike-slip. More specifically a right-lateral strike-slip.

6 0

3 years ago

Question 3) A 1.00 L buffer solution is 0.250 M in HF and 0.250 M in LiF. Calculate the pH of the solution after the addition of

Masja [62]

The pH of the solution after adding 0.150 moles of solid LiF is 3.84

Explanation:

We have the chemical equation,

HF (aq)+NaOH(aq)->NaF(aq)+H2O

To find how many moles have been used in this

c= n/V=> n= c.V

nHF=0.250 M⋅1.5 L=0.375 moles HF

Simillarly

nF=0.250 M⋅1.5 L=0.375 moles F

nHF=0.375 moles - 0.250 moles=0.125 moles

nF=0.375 moles+0.250 moles=0.625 moles

[HF]=0.125 moles/1.5 L=0.0834 M

[F−]=0.625 moles/1.5 L=0.4167 M

To determine the problem using the Henderson - Hasselbalch equation

pH=pKa+log ([conjugate base/[weak acid])

Find the value of Ka

pKa=−log(Ka)

pH=−log(Ka) +log([F−]/[HF]

pH= -log(3.5 x 10 ^4)+log(0.4167 M/0.0834 M)

pH=-log(3.5 x 10 ^4)+log(4.996)

pH= -4.54+0.698

pH=-(-3.84)

pH=3.84

The pH of the solution after adding 0.150 moles of solid LiF is 3.84

5 0

3 years ago

If 200 ml of 0.15 M propionic acid (PA) is added to 300 ml of 0.02 M NaOH, what is the resulting pH of the solution? Round the a

vodomira [7]

Answer:

pH = 4.543

Explanation:

CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
pKa = - Log Ka

∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]

∴ pKa = 4.87

⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]

added 300 mL 0f 0.02 M NaOH:

⇒ C CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)

⇒ C CH3CH2COOH = 0.048 M

⇒ C NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M

mass balance:

⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)

charge balance:

⇒ [H3O+] + [Na+] = [CH3CH2COO-]

∴ [Na+] = 0.02 M

⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)

(2) in (1):

⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]

replacing in Ka:

⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])

⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]

⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]

⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0

⇒ [H3O+ ] = 2.867 E-5 M

∴ pH = - Log [H3O+]

⇒ pH = 4.543

3 0

3 years ago