Answer:
51207 torr is the new pressure of the gas
Explanation:
We can solve this question using combined gas law that states:
P1V1T2 = P2V2T1
<em>Where P is pressure, V volume and T absolute temperature of 1, initial state and 2, final state of the gas</em>
<em> </em>
Computing the values of the problem:
P1 = 710torr
V1 = 5.0x10²mL
T1 = 273.15 + 30°C = 303.15K
P2 = ?
V2 = 25mL
T2 = 273.15 + 820°C = 1093.15K
Replacing:
710torr*5.0x10²mL*1093.15K = P2*25mL*303.15K
3.881x10⁸torr*mL*K = P2 * 7.579x10³mL*K
P2 = 51207 torr is the new pressure of the gas
Answer:
116.3 grCO2
Explanation:
1st - we balance the equation so that it finds the same amount of elements of the product side and of the reagent side
C6H6 +15/2 O2⟶ 6CO2 +3 H2O
2nd - we calculate the limiting reagent
39.2gr C6H6*(240grO2/78grC6H6)=120 grO2
we don't have that amount of oxygen so this is the excess reagent and oxygen the limiting reagent
3rd - we use the limiting reagent to calculate the amount of CO2 in grams
105.7grO2*(264grCO2/240grO2)=116.3 grCO2
Answer:
I think it's gold but I'm not sure, sorry
Explanation:
good luck tho :)
<span>The answer is B.They cannot produce enough heat to keep their bodies warm.
In order to survive, the alligators rely on warm weather, and they are most active when the environment is 82-92 degrees Fahrenheit. They can survive below or above this temperature range but they may spend that time struggling to stay warm or stay cool.
</span>
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
