1.5052g BaCl2.2H2O => 1.5052g / 274.25 g/mol = 0.0054884 mol
=> 0.0054884 mol Ba
<span>This means that at most 0.0054884 mol BaSO4 can form since Ba is the limiting reagent. </span>
<span>0.0054884 mol BaSO4 => 0.0054884 mol * 233.39 g/mol = 1.2809 g BaSO4</span>
So, the answer to 27.) would be <em>2x.</em> Both 6x and 2x can be divided by 2x, but they can't go any higher without the end-answer becoming a fraction. As such, 2x is the greatest common factor.
For 28.), x and x^2 can't be like terms, since like terms have the same variable and exponent :)
Hope I could help!
Answer:
The answer is
<h2>11.73 mL</h2>
Explanation:
The volume of a substance when given the density and mass can be found by using the formula
From the question
mass of object = 30.5 g
Density = 2.6 g/cm³
The volume is
We have the final answer as
<h3>11.73 mL</h3>
Hope this helps you
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
Answer:
I have the same
Explanation:
like I have the same homework as you are u in my class lol?
