The object has an overall positive charge.
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Silicon is the element having a mass of 28.09 g
<u>Explanation</u>:
- Silicon is the element having an atomic mass of 28.09 g / mol. So 28.09 g of silicon contains 6.023
10^23 atoms. One mole of each element can produce one mole of compound.
- The Atomic weight of an element can be determined by the number of protons and neutrons present in one atom of that element. So atomic weight expressed in grams always contain the same number of atoms( 6.023 10^23).
- Avagadro number is the number of atoms of 1 mole of any gas at standard temperature and pressure. It has been determined that 6.023 10^23 atoms of an element are equal to the average atomic mass of that element.
This is an acid – base reaction and this always result a salt and water
in a neutralization reaction. <span>
The salt that is formed will be calcium bromide (calcium
is located in group 2 so calcium bromide has a formula of CaBr2)
so essentially we got:
HBr + Ca(OH)2 ------> CaBr2 + H2O </span>
balancing the elements: <span>
<span>2HBr(aq) + Ca(OH)2(aq) --------> CaBr2(aq) +
2H2O(l)</span></span>
The molarity is moles/liters.
First, convert 4,000 mL to L:
4000 mL --> 4 L
Now, you must convert the 17 g of solute to moles by dividing the number of grams by the molar mass. The molar mass of AgNO3 is <span>169.87 g/mol:
17 / 169.87 = .1
Now that you have both the number of moles and the liters, plug them into the initial equation of moles/liters:
.1/4 = .025</span>
