Question

Count the number of each type of atom in the equation below, and then balance the equation. Write In the numbers of atoms and coefficient. Add a 1 if there should be no coefficient.
CS2(I)+O2(g)-CO2(g)+SO2(g)

__C __ S __ - __C __S __O



__ CS2(I)+ __ O2(g)- __ CO2(g)+__ SO2(g)
​

Answer 1

1,2,2,1,1,4 is the numbers for the first equation

Answer 2

Answer:

Balanced equation

CS2(l) + 3O2(g)------> CO2(g) + 2SO2(g)

Explanation:

For a chemical equation to be balanced, the number of atoms of each element on the left Hans side of the reaction equation must equal the number of atoms of that element on the right hand side of the reaction equation.

Atoms of oxygen are six on both sides of the reaction equation. Atoms of sulphur are two while there is only one atom of carbon on both sides of the reaction equation.