All categories

3 years ago

What is the ability to transfer thermal energy to something else

Chemistry

1 answer:

Fofino [41]3 years ago

6 0

Answer:

.Heat energy can be transferred from one object to another. The transfer or flow due to the difference in temperature between the two objects is called heat.

Explanation:

The transfer of thermal energy is called heat. In this process, thermal energy moves through a substance. For example, an ice cube has heat energy and so does a glass of lemonade.

You might be interested in

How do you convert ethane to ethanoic acid? Please provide your equation.

tigry1 [53]

ester of Ethanol and Ethanoic Acid is Ethyl Ethanoate. 

C2H5OH(l)+CH3COOH(l)conc.H2SO4/warm−−−−−−−−−−−→CH3COOCH2CH3(aq)+H2O(l)C2H5OH(l)+CH3COOH(l)→conc.H2SO4/warmCH3COOCH2CH3(aq)+H2O(l)
Condition: Warm con. reactants with conc.Condition: Warm con. reactants with conc.H2SO4H2SO4

7 0

2 years ago

An aqueous 0.300 M glucose solution is prepared with a total volume of 0.150 L. The molecular weight of

kherson [118]

Answer:

We need 8.11 grams of glucose for this solution

Explanation:

Step 1: Data given

Molarity of the glucose solution = 0.300 M

Total volume = 0.150 L

The molecular weight of glucose = 180.16 g/mol

Step 2: Calculate moles of glucose in the solution

Moles glucose = molarity solution * volume

Moles glucose = 0.300 M * 0.150 L

Moles glucose = 0.045 moles glucose

Step 3: Calculate mass of glucose

MAss glucose = moles glucose* molecular weight of glucose

MAss glucose = 0.045 moles * 180.16 g/mol

MAss glucose = 8.11 grams

We need 8.11 grams of glucose for this solution

6 0

3 years ago

Enter the correct ground-state (or lowest energy) configuration based on the number of electrons: 1s^4 2s^4 2p^12.

Blababa [14]

Answer:

The ground state configuration is the lowest energy, most stable arrangement. An excited state configuration is a higher energy arrangement (it requires energy input to create an excited state). Valence electrons are the electrons utilised for bonding.

or the

FIGURE 5.9 The arrow shows a second way of remembering the order in which sublevels fill. Table 5.2 shows the electron configurations of the elements with atomic numbers 1 through 18.

Element Atomic number Electron configuration

sulfur 16 1s22s22p63s23p4

chlorine 17 1s22s22p63s23p5

argon 18 1s22s22p63s23p6

or the

Two electrons

Two electrons fill the 1s orbital, and the third electron then fills the 2s orbital. Its electron configuration is 1s22s1.

Explanation:

Choose your answer 

brainlilest me

CARRY ON LEARNING

6 0

2 years ago

What is 0.3m equal to mm?

madreJ [45]

0.3×100cm=300cm

300cm×10mm=3000

4 0

2 years ago

Carbon-14 has a half-life of 5720 years and this is a fast-order reaction. If a piece of wood has converted 75 % of the carbon-1

Nana76 [90]

Answer:

11445.8years

Explanation:

Half-life of carbon-14 = 5720 years

First we have to calculate the rate constant, we use the formula :

7 0

3 years ago