All categories

2 years ago

135 Joules of heat are required to increase the temperature of 10.0 grams of an unknown metal from 25.0∘C to 40.0∘C:

Chemistry

1 answer:

Sever21 [200]2 years ago

8 0

Answer:

270 Joules

Explanation:

The specific heat capacity equation will be used for this question i.e.

Q = m. c. ΔT

Where; Q = Amount of heat

m = mass of substance

C = specific heat capacity of

substance

ΔT = change in temperature

(Final temp - initial temp)

However, for this unknown metal, we need to find the specific heat first by saying; C = Q / mΔT

Q= 135J, C=?, m= 10g, ΔT = (40-25 = 15°C)

C = 135 / 15 × 10

C = 135/150

C = 0.9 J/g°C

If the specific heat capacity of the unknown metal is 0.9 J/g°C, then at a mass of 20.0g, and a ΔT of 15°C, the amount of heat needed is:

Q = m. c. ΔT

Q = 20 × 0.9 × (40-25)

Q = 18 × 15

Q = 270J

270 Joules of heat is needed to increase the temperature of 20g of the metal from 25 - 40°C

You might be interested in

Using the idea that reactions occur as a result of collisions between particles, explain why reaction rates depend on the temper

PIT_PIT [208]

Increasing temperatures in a reaction increases the kinetic energy of the reactant molecules. This causes them to move fast and hence collide with a higher frequency. The higher the rate of collision between the molecules, the faster the reaction.

6 0

2 years ago

NEED HELP ASAP WILL MARK BRAINLIEST

Andreas93 [3]

Answer: only O is unbalanced

Explanation:

There are only 2 oxygen atoms on the left but in the right there are 4

8 0

3 years ago

Potassium chlorate decomposes into potassium chloride and oxygen gas. How many grams of oxygen are produced when 1.06 grams of p

kifflom [539]

The amount of oxygen that are produced when 1.06 grams of potassium chlorate decompose completely is 0.64 grams.

<h3>What is the relation between mass & moles?</h3>

Relation between the mass and moles of any substance will be represented as:

n = W/M, where
W = given mass
M = molar mass

Moles of potassium chlorate = 1.66g / 122.5g/mol = 0.0135mole

Given chemical reaction is:

2KClO₃ → 2KCl + 3O₂

From the stoichiometry of the reaction, it is clear that:

2 moles of KClO₃ = produces 3 moles of O₂

0.0135 moles of KClO₃ = produces (3/2)(0.0135)=0.02 moles of O₂

Mass of oxygen = (0.02mol)(32g/mol) = 0.64 g

Hence produced mass of oxygen is 0.64 grams.

To now more about mass & moles, visit the below link:
brainly.com/question/18983376

#SPJ1

5 0

2 years ago

How many kilojoules are released when 116 g of Cl2 reacts with silicon? Si(s)+2Cl2(g)→SiCl4(g)ΔH=−657kJ

alexandr402 [8]

Answer:- 537 kJ of heat is released.

Solution:- For the given equation, $\Delta H$ is -657 kJ and the coefficient of $Cl_2$ in the balanced equation is 2. It means 657 kJ of heat is released when 2 moles of chlorine are used. We need to calculate the heat released when 116 g of $Cl_2$ are used.

Grams of chlorine are converted to moles and then multiplied by the $\Delta H$ value and divided by the coefficient of chlorine and the set could be shown using dimensional analysis as:

$116gCl_2(\frac{1mol}{70.9g})(\frac{657kJ}{2mol})$

= 537.46 kJ

If we use the correct sig figs then it needs to be round off to three sig figs as the given grams of chlorine has only three sig figs. So, 537 kJ of heat is released.

6 0

2 years ago

Linolenic acid has cis double bonds with the formula ch3ch2ch=chch2ch=chch2ch=ch(ch2)7cooh. write out the abbreviated systematic

valentinak56 [21]

<span>Abbreviated systematic numbering for Linolenic Acid is,

18:3, n-3
Explanation:
In above abbreviation 18 specifies number of carbon atoms in Linolenic Acid, 3 specifies the number of double bonds and n-3 specifies the position of first double bond from methyl end. The structure of Linolenic Acid is as follow,</span>

3 0

3 years ago