Answer:
Mass of liquid: 20.421g
Density= 1.0109405940594 g/mL
Explanation:
Mass of liquid
To find mass of liquid you take the mass of beaker + liquid (171.223g) and subtract it from the Mass of beaker (beaker without the water). The difference is the answer.
171.223g - 150.802g = 20.421g
Density
To find density you use the formula Mass/Volume. Take the Volume given, and the mass of the liquid you just found.
20.421mL/20.421g = 1.0109405940594 g/mL
Answer:
The calculations are in the explanation below.
The <em>steps </em>are:
- 1. Using a graduated pipette, accurately take 25mL of the 12.0M stock solution.
- 2. Pour the 25mL of stock solution into a 100 mL volumetric flask
- 3. Add distilled water up to the mark
- 4. Cap the flask with the stopper
- 5. Stirr by gently rotating the flask.
Explanation:
To make 100 mililiter of the 3.0M solution of sulfuric acid, first you must calculate the volume of the 12.0M stock solution that contains the same number of moles as the diluted solution.
For that, you use the dilution formula:
- number of moles = C₁V₁ = C₂V2
- V₁ = 3.0M × 100mL/12.0M = 25mL
Then, the steps are:
1. Using a graduated pipette, accurately take 25mL of the 12.0M stock solution.
2. Pour the 25mL of stock solution into a 100 mL volumetric flask
3. Add distilled water up to the mark
4. Cap the flask with the stopper
5. Stirr by gently rotating the flask.
In order to synthesize a complex organic molecule, the
chemist should at least illustrate or imagine the bonds that are in need to be
cut down or to separate in order to obtain the compound that can be easily
changed.
Answer:
Fatty Acids
A lipid is an organic compound such as fat or oil. Organisms use lipids to store energy, but lipids have other important roles as well. Lipids consist of repeating units called fatty acids. Fatty acids are organic compounds that have the general formula CH3(CH2)nCOOH" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 17.6px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">CH3(CH2)nCOOHCH3(CH2)nCOOH, where n" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 17.6px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">nn usually ranges from 2 to 28 and is always an even number. There are two types of fatty acids: saturated fatty acids and unsaturated fatty acids.
Saturated Fatty Acids
In saturated fatty acids, carbon atoms are bonded to as many hydrogen atoms as possible. This causes the molecules to form straight chains, as shown in the figure below. The straight chains can be packed together very tightly, allowing them to store energy in a compact form. This explains why saturated fatty acids are solids at room temperature. Animals use saturated fatty acids to store energy.
Figure 14.2.1" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 16px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">14.2.114.2.1: Structures of saturated and unsaturated fatty acids.
Unsaturated Fatty Acids
In unsaturated fatty acids, some carbon atoms are not bonded to as many hydrogen atoms as possible due to the presence of one or more double bonds in the carbon chain. Instead, they are bonded to other groups of atoms. Wherever carbon binds with these other groups of atoms, it causes chains to bend (see figure above). The bent chains cannot be packed together very tightly, so unsaturated fatty acids are liquids at room temperature. Plants use unsaturated fatty acids to store energy.
Figure 14.2.2" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 16px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">14.2.214.2.2: Saturated fatty acids have only single bonds while monounsaturated fats have one double bond and polyunsaturated fats have more than one double bond.
Lipids and Diet
Unsaturated fat is generally considered to be healthier because it contains fewer calories than an equivalent amount of saturated fat. Additionally, high consumption of saturated fats is linked to an increased risk of cardiovascular disease. Some examples of foods with high concentrations of saturated fats include butter, cheese, lard, and some fatty meats. Foods with higher concentrations of unsaturated fats include nuts, avocado, and vegetable oils such as canola oil and olive oil.
In one glucose you have
6 carbon atoms
12 hydrogen atoms
6 oxygen atoms
if you have 3 then you are going to multiply the atoms by 3. 6 times 3 is 18.
you have 18 OXYGEN MOLECULES
