Answer:
becomes runoff and finds its way back to the ocean
Explanation:
Precipitation refers to rainfall that reaches the earth.
Most of the rainfall that reaches the earth becomes runoff and finds its way back to the ocean.
When the rain falls on earth, some evaporates, some enters into the ground while some runs off into rivers and streams. Almost all of the rain water flows into the oceans or other bodies of water.
Hence, most of the rainfall that reaches the earth becomes runoff and finds its way back to the ocean
pH of the buffer solution is 1.76.
Chemical dissociation of formic acid in the water:
HCOOH(aq) ⇄ HCOO⁻(aq) + H⁺(aq)
The solution of formic acid and formate ions is a buffer.
[HCOO⁻] = 0.015 M; equilibrium concentration of formate ions
[HCOOH] + [HCOO⁻] = 1.45 M; sum of concentration of formic acid and formate
[HCOOH] = 1.45 M - 0.015 M
[HCOOH] = 1.435 M; equilibrium concentration of formic acid
pKa = -logKa
pKa = -log 1.8×10⁻⁴ M
pKa = 3.74
Henderson–Hasselbalch equation: pH = pKa + log(cs/ck)
pH = 3.74 + log (0.015 M/1.435 M)
pH = 3.74 - 1.98
pH = 1.76
More about buffer: brainly.com/question/4177791
#SPJ4
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
Answer: fixed shape and volume
Explanation:
i took the quiz so its right
Which lists the correct order of the steps?<br> 4,2,1,3<br>4,1,3,2<br> 4,3,1, 2<br>4, 2, 3.1
Alik [6]
Answer:
4,3,1,2 thise is my answer.
