Nitrogen is ...19.7
flourine is 80.3...
hope this helps!
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
2Agl + 1Na2S----->1 Ag2S + 2Nal
This may help
<h3>
Answer:</h3>
2.5 moles
<h3>
Explanation:</h3>
<u>We are given;</u>
We are required to determine the number of moles of sodium.
- We know that, 1 mole of an element contains a number of atoms equivalent to the Avogadro's number, 6.022 × 10^23.
- That is, 1 mole of an element = 6.022 × 10^23 atoms.
Therefore;
1 mole of sodium contains 6.022 × 10^23 atoms
To get the number of moles;
= Number of atoms ÷ Avogadro's number
= 1.5 × 10^24 atoms ÷ 6.022 × 10^23 atoms/mol
= 2.49 moles
= 2.5 moles
Therefore, 2.5 moles of sodium contains 1.50 × 10^24 sodium atoms
