Explanation:
Molar mass of 
= 39.1 + 35.5 + 3(16.0) = 122.6 g
Molar mass of KCl = 39.1 + 35.5 = 74.6 g
Molar mass of 
= 32.0 g
According to the equation, 2 moles of reacts to give 3 moles of oxygen.
Therefore, 2 (122.6) = 245.2 g of will give 3 (32.0) = 96.0 g of oxygen. Thus, 245.2 g of gives 96.0 g of oxygen.
(a) Calculate the amount of oxygen given by 2.72 g of as follows.
of
(b) Calculate the amount of oxygen given by 0.361 g of as follows.
of
c) Calculate the amount of oxygen given by 83.6 kg as follows.
of
Convert kg into grams as follows.
= 32731 g of
(d) Calculate the amount of oxygen given by 22.5 mg of as follows.
Convert mg into grams as follows.
of
<span>The region(s) of the periodic table which are
made up of elements that can adopt both positive and negative oxidation numbers
are the “non-metal” region. As we can see on the periodic table, the elements situated
at the right side of the table have two oxidation states, one positive and the
other a negative. </span>
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
Answer:
A cold front forms when a cold air mass pushes into a warmer air mass. Cold fronts can produce dramatic changes in the weather. ... As the cold front passes, winds become gusty. There is a sudden drop in temperature, and also heavy rain, sometimes with hail, thunder, and lightning.
