All categories

3 years ago

The amount of heat energy required to raise the temperature of a unit mass of a material one degree is

Chemistry

1 answer:

kherson [118]3 years ago

7 0

I think its B- A Joule

You might be interested in

If the molar mass of NaCl is 58.44 g/mol, what amount of NaCl (in mol) is contained in 250.0 mg of NaCl?

4vir4ik [10]

Answer: 0.004 moles

Explanation:

Amount of substance= mass/ molar mass

Mass= 250mg or 0.25g

Molar mass= 58.44gmol-1

Amount= 0.25/58.44

= 0.004 moles

5 0

2 years ago

Your boss tells you that water at 68 F is flowing in a cooling tower loop at a rate of 600 gpm, in an 8-inch inside diameter pip

avanturin [10]

Explanation:

The volumetric flow rate of water will be as follows.

q = $600 gpm \times \frac{0.000063 m^{3} s^{-1}}{1 gpm}$

= 0.0378 $m^{3}/s
$

Diameter = $8 in \times \frac{0.0254 m}{1 in}$

= 0.2032 m

Relation between area and diameter is as follows.

A = $\frac{\pi}{4} \times D^{2}$

= $\frac{3.14}{4} \times (0.2032 m)^{2}$

= 0.785 x 0.2032 x 0.2032

= 0.0324 $m^{2}$

Also, q = A × V

or, V = $\frac{q}{A}$

= $\frac{0.0378 m^{3}/s}{0.0324 m^{2}}$

= 1.166 m/s

As, viscosity of water = 1 cP = $10^{-3}$ Pa-s

Density of water = 1000 $kg/m^{3}$

Therefore, we will calculate Reynolds number as follows.

Reynolds number = $\frac{D \times V \times density}{viscosity}$

= $\frac{0.2032 m \times 1.166 m/s \times 1000}{10^{-3}}$

= 236931.2

Hence, the flow will be turbulent in nature.

Thus, we can conclude that the Reynolds number is 236931.2 and flow is turbulent.

8 0

2 years ago

Write the word equation for the chemical reaction: Zn(s)+2HCl2(aq)--->ZnCl2(aq)+H2(g)

Vikki [24]

Zn(s) + 2HCl(aq) = ZnCl₂(aq) + H₂(g)

zinc + hydrochloric acid = zinc chloride + hydrogen

4 0

2 years ago

Write the equilibrium expression of each chemical equation. 2H2S(g) 2H2(g) + S2(g)

hodyreva [135]

Answer:

[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2

Explanation:

2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)

The equilibrium constant expression in terms of concentrations is:

Kc=[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2.

6 0

2 years ago

Why is a typical car battery in a car is filled with a solution of sulferic acid

Lesechka [4]

Answer:

Sulfuric acid has a higher density than water, which causes the acid formed at the plates during charging to flow downward and collect at the bottom of the battery.

8 0

2 years ago