All categories

3 years ago

G what is the difference between the sidechains of leucine and isoleucine? select one:

Chemistry

1 answer:

statuscvo [17]3 years ago

4 0

c. Isoleucine has a carbon “branched” closer to the alpha carbon than does leucine.

The structure of leucine is CH3CH(CH3)CH2CH(NH2)COOH.

The structure of isoleucine is CH3CH2CH(CH3)CH(NH2)COOH.

In leucine, the CH3 group is two carbons away from the α carbon; in isoleucine, the CH3 group is on the carbon next to the α carbon.

Thus, isoleucine has the closer branched carbon.

“One is charged, the other is not” is incorrect. Both compounds are uncharged.

“One has more H-bond acceptors than the other” is incorrect. Each acid has two H-bond acceptors — the N in the amino and the O in the carbonyl group.

“They have different numbers of carbon atoms” is incorrect. They each contain six carbon atoms.

You might be interested in

A plant extract can be obtained with organic solvents such as acetone or ethyl alcohol, and is composed of plant pigments such a

prohojiy [21]

Answer:

Here's what I get

Explanation:

A plant extract is a mixture because it contains different substances: acetone or ethanol, chlorophylls A and B, carotene and xanthophylls.

It is homogeneous because it is a solution. There is only one phase: the liquid phase. You cannot see the pigments as separate phases.

You can separate the pigments by paper, thin layer, or column chromatography.

Many schools use paper chromatography, because paper is cheap.

As the mixture of pigments follows the solvent up the paper, they separate into different coloured bands according to their attractive forces to the cellulose in the paper.

The chlorophylls are strongly attracted to the paper, so they don't travel very far.

The nonpolar carotene molecules have little attraction to the polar cellulose, so they are carried along by the solvent front.

8 0

3 years ago

A sample of water at 100°C is converted to steam after absorbing 820 kJ of heat. How grams of H2O are contained in the sample? A

Varvara68 [4.7K]

Since water is already at 100°C all the energy is used to evaporate it.
Now we can calculate how many mols of water are evaporated with 820kJ.
$N= \frac{820}{41} =20 mol$
We calculated that we got 20 mols of water evaporated. Now, all we have to do is find how many grams is a mol of water. Molar mass of water is 20.16 g/mol.
The final answer is:
$m=20*20.16=403.2g$

7 0

3 years ago

When 40 grams of ammonium nitrate explode 14 grams of nitrogen and 8 grams of oxygen form. How many grams of water form

DerKrebs [107]

Answer:

18 grams of water

Explanation:

The Balance Chemical Reaction is as follow,

2 NH₄NO₃ → 2 N₂ + O₂ + 4 H₂O

According to Equation,

160 g (2 moles) NH₄NO₃ produces = 72 g (4 moles) of H₂O

So,

40 g of NH₄NO₃ will produce = X g of H₂O

Solving for X,

X = (40 g × 72 g) ÷ 160 g

X = 18 g of H₂O

Hope This Helps!

4 0

2 years ago

If two metals has the same specific heat how can distinguish them in two ways

tensa zangetsu [6.8K]

Explanation:

1) Thermal and Electric conductivity

2) Metallic strength

5 0

2 years ago

Convert 6.7 x 1024 molecules of nitrogen dioxide into grams.

BlackZzzverrR [31]

Answer:

510 g NO₂

General Formulas and Concepts:

Avogadro's Number - 6.022 × 10²³ atoms, molecules, formula units, etc.
Reading the Periodic Table
Writing Compounds
Using Dimensional Analysis

Explanation:

Step 1: Define

6.7 × 10²⁴ molecules NO₂ (Nitrogen dioxide)

Step 2: Define conversions

Avogadro's Number

Molar Mass of N - 14.01 g/mol

Molar Mass of O - 16.00 g/mol

Molar Mass of NO₂ - 14.01 + 2(16.00) = 46.01 g/mol

Step 3: Use Dimensional Analysis

$6.7 \cdot 10^{24} \ molecules \ NO_2(\frac{1 \ mol \ NO_2}{6.022 \cdot 10^{23} \ molecules \ NO_2} )(\frac{46.01 \ g \ NO_2}{1 \ mol \ NO_2} )$ = 511.901 g NO₂

Step 4: Check

We are given 2 sig figs. Follow sig fig rules.

511.901 g NO₂ ≈ 510 g NO₂

6 0

2 years ago