G what is the difference between the sidechains of leucine and isoleucine? select one:

Chemistry

1 answer:

statuscvo [17]3 years ago

4 0

c. Isoleucine has a carbon “branched” closer to the alpha carbon than does leucine.

The structure of leucine is CH3CH(CH3)CH2CH(NH2)COOH.

The structure of isoleucine is CH3CH2CH(CH3)CH(NH2)COOH.

In leucine, the CH3 group is two carbons away from the α carbon; in isoleucine, the CH3 group is on the carbon next to the α carbon.

Thus, isoleucine has the closer branched carbon.

“One is charged, the other is not” is incorrect. Both compounds are uncharged.

“One has more H-bond acceptors than the other” is incorrect. Each acid has two H-bond acceptors — the N in the amino and the O in the carbonyl group.

“They have different numbers of carbon atoms” is incorrect. They each contain six carbon atoms.

You might be interested in

Is it possible for two different compounds to be made from the exact same two elements? Why or why not? With a limited number of

daser333 [38]

Answer:

Yes. The two elements can combine to form different compounds.

Explanation:

Two elements can combine at different ratios.

Consider CO and CO₂. Both are made from carbon and oxygen. However, C and O combine at a 1:1 ratio in CO but at a 1:2 ratio in CO₂. CO is a fuel; it burns in the air. CO₂ does not burn in the air; it is used to put out fires and is found in extinguishers. CO and CO₂ are two distinct compounds.

There are many ways for the elements to combine with each other. As a result, the first twenty elements on the periodic table alone can produce a large number of compounds.

6 0

2 years ago

What is science of love?

shtirl [24]

science of love

,EXPLANATION:

The initial happy feelings of being in love is stimulated by 3 chemicals in the brain: noradrenaline that stimulates adrenaline production causing that racing heart and sweaty palms; dopamine, the feel-good chemical; and phenylethylamine that is released when we're near our crush, giving us butterflies in our tummies.