All categories

3 years ago

G what is the difference between the sidechains of leucine and isoleucine? select one:

Chemistry

1 answer:

statuscvo [17]3 years ago

4 0

c. Isoleucine has a carbon “branched” closer to the alpha carbon than does leucine.

The structure of leucine is CH3CH(CH3)CH2CH(NH2)COOH.

The structure of isoleucine is CH3CH2CH(CH3)CH(NH2)COOH.

In leucine, the CH3 group is two carbons away from the α carbon; in isoleucine, the CH3 group is on the carbon next to the α carbon.

Thus, isoleucine has the closer branched carbon.

“One is charged, the other is not” is incorrect. Both compounds are uncharged.

“One has more H-bond acceptors than the other” is incorrect. Each acid has two H-bond acceptors — the N in the amino and the O in the carbonyl group.

“They have different numbers of carbon atoms” is incorrect. They each contain six carbon atoms.

You might be interested in

Baking soda reacts with vinegar and forms a gas why is it chemical

777dan777 [17]

Its a chemical reaction because both are affected by the reaction and changed. hope this helps (ू• o •ू )

4 0

3 years ago

Read 2 more answers

What is every cell that contains certain structures that perform specialized functions

Andrej [43]

I think this one is the organelles.

8 0

3 years ago

If a sample is thought to be several million years old, which method would best help to determine its absolute age?

Makovka662 [10]

The answer is B)Ar-40/k-40

6 0

3 years ago

Acetic acid has a pKa of 4.74. Buffer A: 0.10 M HC2H3O2, 0.10 M NaC2H3O2 Buffer B: 0.30 M HC2H3O2, 0.30 M NaC2H3O2 Buffer C: 0.5

e-lub [12.9K]

Answer:

Buffer B has the highest buffer capacity.

Buffer C has the lowest buffer capacity.

Explanation:

An effective weak acid-conjugate base buffer should have pH equal to $pK_{a}$ of the weak acid. For buffers with the same pH, higher the concentrations of the components in a buffer, higher will the buffer capacity.

Acetic acid is a weak acid and $CH_{3}COO^{-}$ is the conjugate base So, all the given buffers are weak acid-conjugate base buffers. The pH of these buffers are expressed as (Henderson-Hasselbalch):

$pH=pK_{a}(CH_{3}COOH)+log\frac{[CH_{3}COO^{-}]}{[CH_{3}COOH]}$

$pK_{a}(CH_{3}COOH)=4.74$

Buffer A: $pH=4.74+log(\frac{0.10}{0.10})=4.74$

Buffer B: $pH=4.74+log(\frac{0.30}{0.30})=4.74$

Buffer C: $pH=4.74+log(\frac{0.10}{0.50})=4.04$

So, both buffer A and buffer B has same pH value which is also equal to $pK_{a}$ . Buffer B has higher concentrations of the components as compared to buffer A, Hence, buffer B has the highest buffer capacity.

The pH of buffer C is far away from $pK_{a}$ . Therefore, buffer C has the lowest buffer capacity.

6 0

2 years ago

Does water evaporates only from the sea

svetlana [45]

Answer:

false

Explanation:

6 0

3 years ago

Read 2 more answers