My answer will be C. Law of Original lateral continuity. :)
6 Na + 1 Fe₂O₃ → 3 Na₂O + 6 Fe
<h3>Explanation</h3>
Method One: Refer to electron transfers.
Oxidation states:
- Na: from 0 to +1; loses one electron.
- Fe: from +3 to 0; gains three electrons.
Each mole of Fe₂O₃ contains two Fe atoms and will gain 2 × 3 = 6 electrons during the reaction. It takes 6 moles of Na to supply all those electrons.
6 Na + 1 Fe₂O₃ → ? Na₂O + ? Fe
- There are two moles of Na atoms in each mole of Na₂O. 6 moles of Na will make 3 moles of Na₂O.
- There are two moles of Fe atoms in each mole of Fe₂O₃. 1 mole of Fe₂O₃ will make 2 moles of Fe.
6 Na + 1 Fe₂O₃ → 3 Na₂O + 2 Fe
Method Two: Atoms conserve.
Fe₂O₃ has the largest number of atoms among one mole of all four species in this reaction. Assume <em>one</em> as its coefficient.
? Na + <em>1</em> Fe₂O₃ → ? Na₂O + ? Fe
There are two moles of Fe atoms and three moles of O atoms in each mol of Fe₂O₃. One mole of Fe₂O₃ contains two moles of Fe and three moles of O. There are one mole of O atom in every mole of Na₂O. Three moles of O will go to three moles of Na₂O.
? Na + <em>1</em> Fe₂O₃ → <em>3</em> Na₂O + <em>2</em> Fe
Each mole of Na₂O contains two moles of Na. Three moles of Na₂O will contain six moles of Na.
<em>6</em> Na + <em>1</em> Fe₂O₃ → <em>3</em> Na₂O + <em>2</em> Fe
Simplify the coefficients. All coefficients in this equation are now full number and relatively prime. Hence the equation is balanced.
6 Na + 1 Fe₂O₃ → 3 Na₂O + 2 Fe
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
<span>PV/T = P'V'/T'
660 x 1.00/295.2 = P' x 1.00/317.8
P'=710.5 torr</span>
