Answer:
Calcium
Explanation:
is a silver-gray metal which takes its name from the Latin word calx, which means lime. It is the fifth most abundant element in the earth's crust and is widely distributed as limestone (CaCO3), quicklime (CaO) and calcium fluoride.
Answer:
Competition occurs when <em>(A) two or more organisms need the same resource.</em>
Explanation:
I dont think it could be (B), (C) or (D) because those don't really make sense.
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
Answer:
6 grains
Explanation:
The equation of the reaction between NaOH and aspirin is;
C9H8O4(aq) + NaOH (aq) ------>C9H7O4Na(aq) + H2O(l)
Amount of NaOH reacted = concentration × volume = 0.1466 M × 14.40/1000 L = 2.11 × 10^-3 moles
Given that aspirin and NaOH react in a mole ratio of 1:1 from the balanced reaction equation above, the number of moles of aspirin reacted is 2.11 × 10^-3 moles
Hence mass of aspirin reacted = 2.11 × 10^-3 moles × 180.2 g/mol = 0.38 g
If 1 grain = 0.0648 g
x grains = 0.38 g
x= 0.38 g/0.0648 g
x= 6 grains
