I think you might find your answer here https://answers.yahoo.com/question/index?qid=20121101101721AAeZyHE
A Biochemist is a type of chemist understands the structure of living systems and, in turn, their functions and ways to control them.
<h3>What is the chemistry of living systems called?</h3>
The chemistry of living system is known as Biochemistry.
Biochemistry is a study of the chemical changes that occur in living organisms.
Scientists that study biochemistry are called Biochemists.
Biochemistry studies the structure and function of biological molecules such as carbohydrates, lipids, proteins, e.t.c., as well the chemical reaction they undergo.
Biochemistry also studies the energy changes that occur in living systems.
In conclusion, the chemistry of living systems is called Biochemistry.
Learn more about biochemistry at: brainly.com/question/12273783
#SPJ1
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Well depends how fast they're going if it's a slow speed a bus but at a fast speed a bike because you wanna be careful while stopping
Answer:
plant cells and eukroyatic algae