The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer:
Amount of Na = 2.17moles
Explanation:
Mass of Na = 50g
Molar mass of Na = 23g/mol
Amount of mole = mass/molar mass
Amount of mole = 50/23
Amount of mole = 2.17moles
Explanation:
so for this u have to use this equation where
Moles = number of particle/6.02×10^23
= 3.045 × 10^24/6.02×10^23
= 5.0581
write it to 3 S.F so 5.06 moles
First one is true second one is False
