He. it is a noble gas and therefore has a full outer shell of electrons. it does not need to gain or loose any.
Explanation:
I think it's from over population and global warming and we can't completely drink sea water
I hope it helps
The alcoholic can seek rehab
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Answer = 4.5
Rationale:
the element Mg comes with a 2+ ion and NO3 comes with -1 ion thus 3 * 1.5 M = 4.5 basically look up what mg ion is on google and it says mg+2 and no3 ion no3- im assuming you cant though so look at the formula.
Mg(NO3)2, mg gave 2 to NO3 but where is mg's number? its 1 so 2+1 = 3
* # M = ans
