<h3>
Answer:</h3>
28.52 seconds
<h3>
Explanation:</h3>
Initial number of atoms of Nitrogen 12,000 atoms
Half-life = 7.13
Number of atoms after decay = 750 atoms
We are required to determine the time taken for the decay.
Note that half life is the time taken for a radioactive isotope to decay to a half of its original amount.
Using the formula;
Remaining amount = Initial amount × (1/2)^n , where n is the number of half lives
In our case;
750 atoms = 12,000 atoms × (1/2)^n
0.0625 = 0.5^n
n = log 0.0625 ÷ log 0.5
n = 4
But, 1 half life =7.13 seconds
Therefore;
Time taken = 7.13 seconds × 4
= 28.52 seconds
Therefore, the time taken for 12,000 atoms of nitrogen to decay to 750 atoms is 28.52 seconds
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer:
A. chocolate chips melting
Explanation:
It is a chemical change. cookies will soften and melt slightly as the cookies bake. the change is solid to liquid.
<span>30.0 ml of 0.15 m K2CrO4 solution will have more potassium ions.
Let's see the relative number of potassium ions for each solution. Since all the measurements are the same, the real difference is the K2CrO4 will only have 2 potassium ions per molecule while the K3PO4 solution will have 3 potassium ions per molecule.
K2CrO4 solution
30.0 * 0.15 * 2 = 9
K3PO4 solution
25.0 * 0.080 * 3 = 6
Since 9 is greater than 6, the K2CrO4 solution will have more potassium ions.</span>
