Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer: Alkali metals, group 1
Explanation: Group 1 means 1 valence electron. This group is called alkali metals, which indicates that it is a metal. They are highly reactive because only 1 electron needs to move to bond with something (since it only has 1 valence electron)
Hydrogenation – meaning, to treat with hydrogen – is a chemical reaction between molecular hydrogen and another compound or element, usually in the presence of a catalyst such as nickel, palladium or platinum. The process is commonly employed to reduce or saturate organic compounds.
Answer:
pH = 2.77
Explanation:
Data Given:
degree of dissociation Ka = 0.057
Concentration of Methanoic acid = 0.005 M
pH = ?
Solution:
First we calculate Hydrogen ion concentration
Formula will be used
[H⁺] = 
. . . . . . (1)
where
Ka = degree of dissociation
c = concentration
Put values in formula 1
[H⁺] = 
. . . . . . (1)
[H⁺] = 0.0017 M
Now Calculate the pH
As we know
pH = -log [H⁺] . . . . . .(2)
Put values in equation
pH = - log [ 0.0017 M]
pH = - [-2.77]
pH = 2.77
So,
pH of methanoic acid = 2.77
