Answer:
A parachute works because the canvas of the parachute is acted upon by inertia.
Explanation:
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer:
a) Ba(OH)₂.8H₂O(s) + <em>2 </em>NH₄SCN(s) → Ba(SCN)₂(s) +<em>10</em> H₂O(l) + <em>2</em> NH₃(g)
b) 3.14g must be added
Explanation:
a) For the reaction:
Ba(OH)₂.8H₂O(s) + NH₄SCN(s) → Ba(SCN)₂(s) + H₂O(l) + NH₃(g)
As you see, there are 8 moles of water in reactants and 2 moles of oxygen in octahydrate, thus, water moles must be 10:
Ba(OH)₂.8H₂O(s) + NH₄SCN(s) → Ba(SCN)₂(s) +<em>10</em> H₂O(l) + NH₃(g)
To balance hydrogens, the other coefficients are:
Ba(OH)₂.8H₂O(s) + <em>2 </em>NH₄SCN(s) → Ba(SCN)₂(s) +<em>10</em> H₂O(l) + <em>2</em> NH₃(g)
b) As you see in the balanced reaction, 1 mole of barium hydroxide octahydrate reacts with 2 moles of NH₄SCN. 6.5g of Ba(OH)₂.8H₂O are:
6.5 g × (1mol / 315.48g) =<em> 0.0206moles of Ba(OH)₂.8H₂O</em>. Thus, moles of NH₄SCN that must be used for a complete reaction are:
0.0206moles of Ba(OH)₂.8H₂O × ( 2 mol NH₄SCN / 1 mol Ba(OH)₂.8H₂O) = <em>0.0412moles of NH₄SCN</em>. In grams:
0.0412moles of NH₄SCN × ( 76.12g / 1mol) = <em>3.14g must be added</em>
Amount of sunlight, amount of water, and amount of fertilizer