Yes the main benifit can be recyclation of energy
- The example can be seen in powerbanks or inverters
- The chemical energy present inside the battery can be used to convert itself into electric energy.
- Which can help us in climate protection
Electrons in an atom can be classified as core electrons and valence electrons. Valence electrons are those electrons which are present in valence shell and participates in bond formation. While, Core electrons are all remaining electrons which are not present in valence shell, hence not take part in bonding.
Atomic number of Selenium (Se) is 34 hence it has 34 electrons with following electronic configuration;
1s², 2s², 2p⁶, 3s², 3p⁶, 4s², 3d¹⁰, 4p⁴
From electronic configuration it is found that the valence shell is 4, and the number of electrons present in valence shell are 6. So,
Core Electrons = Total Electrons - Valence Electrons
Core Electrons = 34 - 6
Core Electrons = 28
Result:
There are 28 core electrons in Selenium.
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer:
22Ω
Explanation:
Given parameters:
Potential difference = 3.3V
Current = 0.15A
Unknown:
Resistance = ?
Solution:
According to ohm's law, potential difference, current and resistance are related by the expression below;
V = I R
where V is the voltage
I is the current
R is the resistance
3.3 = 0.15 x R
R = 
= 22Ω
