A Cell with few energy needs would most likely contain a small number of Mitochondria.
- All cells require energy to function, but cells typically have significant energy needs that can only be met by the mitochondria, the cell's powerhouse.
- They transform glucose into ATP, a chemical with a huge energy storage capacity.
- Muscles have a large number of mitochondria, allowing them to react rapidly and powerfully to the body's ongoing need for energy.
- Macromolecules, defunct cell components, and microbes are all digested by lysosomes.
- Vacuoles are typically tiny and aid in the sequestration of waste.
- The ribosome, an intercellular structure consisting of both RNA and protein, is where a cell produces new proteins.
Therefore out of all these cell organelles, the cell has fewer mitochondria for less energy need.
Learn more about cell organelles here:
brainly.com/question/13408297
#SPJ9
Answer:
Cells are uncountable becasue they move around your body, make up your skin and other organs as well. And because when you grow, the cells multiply, and that makes it very hard for scientists to count cells in a human's body.
Explanation:
Hope this helped!
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Hey there!:
HCl + MnO2 → MnCl2 + H2O + Cl2
* in HCl the oxidation state of Cl is -1 .
* on the product side the oxidation state is 0 .
* therefore Cl gains electrons .
* in MnO2 the oxidation state of Mn is +4
* in MnCl2 the oxidation state of Mn is +2
Therefore Mn loses electrons
Answer A
Hope That helps!
The answer is (4) Ag(s)
Solid Silver has a Face Centered Cubic crystal structure.
The remaining choices are gases (H2 & Ar) and liquid (Br). Liquids and gases do not form crystal structures as their atoms are loose.