Answer:
The play will be more appealing to a younger audience.
Explanation:
A younger audience will more likely appreciate current pop hits rather than classical score.
Answer:
Electron
Explanation:
The answer would be the electron because it is constantly moving so its location cannot be accurately determined
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer:
1. Hydrogen
Explanation:
These planets contain liquid hydrogen in their interior, while the earth has liquid iron in it.
When liquid hydrogen is in tremendous pressure enviroments, the electrons that make up each atom of this element end up "jumping" to other atoms. These "jumps" allow liquid hydrogen to behave like a metal.
In addition, with the constant energy released by the nucleus of planets like Jupiter and Saturn, as well as their rotations, the liquid hydrogen receives induction of currents, giving rise to extremely powerful magnetic fields.
Sorry, I won't understand your words.
