All categories

3 years ago

What is the only chemical that is liquid at room temperature

2 answers:

8 0

The only chemical that is a liquid at room temperature is Mercury. It's toxic, and has a high vapor pressure at room temperature.

FromTheMoon [43]3 years ago

5 0

The only chemical that is liquid at room temperature is mercury.

Answer:mercury

You might be interested in

Which letter corresponds with the location of f orbitals on the periodic table?

Lerok [7]

Answer:

The correct would be C i think :)

Explanation:

Stay postivie :)

8 0

3 years ago

Consider the reaction: 2 SO2(g) + O2(g) <----> 2 SO3. If, at equilibrium at a certain temperature, [SO2] = 1.50 M, [O2] =

vlada-n [284]

Answer:

5.79

Explanation:

The following data were obtained from the question:

Concentration of SO2, [SO2] = 1.50 M

Concentration of O2, [O2] = 0.120 M

Concentration of SO3, [SO3] = 1.25 M

Equilibrium constant, (K) =..?

The balanced equation for the reaction is given below:

2SO2(g) + O2(g) <==> 2SO3(g)

From the balanced equation, the equilibrium constant K is written as follow:

K = [SO3]²/ [SO2]²• [O2]

With the above, the value of the equilibrium constant, K can be obtained as follow

K = [SO3]²/ [SO2]²• [O2]

K = (1.25)² / (1.50)² × 0.120

K = 1.5625 / ( 2.25 x 0.120)

K = 5.79

Therefore, the equilibrium constant is 5.79.

7 0

3 years ago

Draw the alcohol that is the product of the reduction of 3-methylpentanal.

natali 33 [55]

Answer: The product from the reduction reaction is

CH3-CH2-CH(CH3)-CH2-CH2OH

IUPAC name; 3- Methylpentan-1-ol

Explanation:

Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.

Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal

CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;

3-methylpenta-1-ol .

The structure of the product is:

CH3-CH2-CH(CH3)-CH2-CH2OH

7 0

3 years ago

How many grams of cupric sulfate pentahydrate are needed to prepare 50.00 mL of 0.0800M CuSO4× 5H2O?

shepuryov [24]

Explanation:

Molarity is defined as number of moles per liter of solution.

Mathematically, molarity = $\frac{no. of moles}{Volume (in L) of solution}$

It is given that molarity is 0.0800 M and volume is 50.00 mL or 0.05 L.

molarity = $\frac{no. of moles}{Volume of solution in liter}$

0.0800 M = $\frac{no. of moles}{0.05 L}$

no. of moles = 1.6 mol

Therefore, molar mass of cupric sulfate pentahydrate is 249.68 g/mol. So, calculate the mass as follows.

No. of moles = $\frac{mass in grams}{molar mass}$

mass in grams = $no. of moles \times molar mass of CuSO_{4}.5H_{2}O$

= $1.6 mol \times 249.68 g/mol$

= 399.488 g

Thus, we can conclude that 399.488 g of cupric sulfate pentahydrate are needed to prepare 50.00 mL of 0.0800M CuSO4× 5H2O.

4 0

3 years ago

What is the relationship between reaction rate and reaction time

Natali [406]

Answer:

The reaction rate is inversely proportional to the reaction time.

Explanation:

The reaction rate is the change of the concentration of reactants and products with the time.

<em>∵ Reaction rate = - Δ[reactants]/Δt = Δ[products]/Δt.</em>

<em>∴ The reaction rate is inversely proportional to the time, as the reaction rate increases it will take a lower time.</em>

4 0

3 years ago