Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer:
D. I've watched Jurassic park uwu
The substance that can be broken down by chemical means from the choices given is CO (Carbon monoxide). Carbon monoxide is a compound made up of carbon and oxygen and can therefore be broken by chemical means.
A stock solution is a solution of a known concentration. Stock solution has a high concentration and therefore, the known amount of stock solution is used for preparing different concentrations, by diluting the same with the known amount of the solvent being used, such as water.
