CH3NH2 + HOH ==> CH3NH3^+ + OH^-Which molecule/ion accepts a proton. That is the base. Which molecule/ion donates a proton. That is the acid.
A stable subatomic particle known by the symbol for "proton"
e elementary charge, p, H+, or 1H+ having a positive electric charge. Its mass is 1,836 times greater than an electron's mass and just a little bit less than that of a neutron (the proton–electron mass ratio). "Nucleons" refers to protons and neutrons together, each of which has a mass of roughly one atomic mass unit (particles present in atomic nuclei).
Each atom. has a nucleus. that contains one or more protons. In order to keep the atomic electrons bound, they offer the central attractive electrostatic force. An element's defining characteristic, known as the atomic number, is the number of protons in the nucleus (represented by the symbol Z)
Learn more about proton here:
brainly.com/question/1252435
#SPJ4
From the calculations, the pH of the buffer is 3.1.
<h3>What is the pH of the buffer solution?</h3>
The Henderson-Hasselbach equation comes in handy when we deal with the pH of a buffer solution. From that equation;
pH = pKa + log[(salt/acid]
Amount of the salt = 25/1000 * 0.50 M = 0.0125 moles
Amount of the acid = 75/1000 * 1.00 M = 0.075 moles
Total volume = ( 25 + 75)/1000 = 0.1 L
Molarity of salt = 0.0125 moles/0.1 L = 0.125 M
Molarity of the acid = 0.075 moles/0.1 L = 0.75 M
Given that the pKa of lactic acid is 3.86
pH = 3.86 + log( 0.125/0.75)
pH = 3.1
Learn more about pH:brainly.com/question/5102027
#SPJ1
They will become unequivalent
What is the average velocity of atoms in 1.00 mol of argon (a monatomic gas) at 275 k for m, use 0.0399kg
Answer: The average velocity of the atoms 847.33 m/s.
Explanation:
Moles of the neon = 1.00
Temperature of the gas : 288 K
Mass of the gas = 0.01000
R = 8.31 J/mol K
The average velocity of the atoms 847.33 m/s.
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
