Answer:
4804.5 g of SO₂ are needed to the reaction
Explanation:
The reaction to produce sulfuric acid is:
2SO₂ + O₂ + 2H₂O → 2H₂SO₄
Ratio is 1:2. 1 mol of oxygen needs 2 moles of sulfur dioxide in order to react. We can propose this rule of three.
If 1 mol of O₂ react to 2 moles of SO₂
Then, 37.50 moles of O₂ will react with (37.5 . 2) /1 = 75 moles of SO₂
We convert the moles to mass, to know the answer:
75 mol . 64.06 g / 1 mol = 4804.5 g of SO₂
Answer:
<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u>
Explanation:
2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)
The equilibrium constant expression in terms of concentrations is:
Kc=<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u><u>.</u>
There are things called "Reactants" and "Products" All chemical equations look something like "A + B →C (+ D...)," in which each letter variable is an element or a molecule (a collection of atoms held together by chemical bonds). The arrow represents the reaction or change taking place. Some equations may have a double-headed arrow (↔), which indicates that the reaction can proceed either forward or backward. When a compound has been written out, you must identify the elements and know their chemical symbols. The first element written is “first name” of the compound. Use the periodic table to find the chemical symbol for the element. So here is an example: Dinitrogen hexafluoride. The first element is nitrogen and the chemical symbol for nitrogen is N. To know the numbers of atoms that are present for each element you can just look at the prefix from the element For example: Dinitrogen has a the prefix “di-“ which means 2; therefore, there are 2 atoms of nitrogen present.
Write dinitrogen as N2.
Now for the second element or "last name" of the compound whatever will follow the first element so like; Dinitrogen hexafluoride. The second element is fluorine. Simply replace the “ide” ending with the actual element name. The chemical symbol for fluorine is F.
But the more you practice with, the easier it will be to decipher chemical formulas in the future and learn the language of chemistry.
Sulfur dioxide: SO2
Carbon tetrabromide: CBr4
Diphosphorus pentoxide: P2O5 ← That is one of the examples I'll give you.
have a gooooood daaaaayy
Sources of pollution can be natural, but they are often human-related.
Sources of pollution include dirt, bacteria, and fertilizers.
Answer:
it takes 100 gallons longer to boil then it does 1 gallon
Explanation:
brainliest please??
