Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Answer:
Explanation:Do you like to draw coz you put the D in raw
Answer:
There is a couple different ways to determine if a bond is ionic or covalent. By definition, an ionic bond is between a metal and a nonmetal, and a covalent bond is between 2 nonmetals. So you usually just look at the periodic table and determine whether your compound is made of a metal/nonmetal or is just 2 nonmetals.
Explanation:
It is always the same as it was before the collision because there is no outside forces it is left with the same amount of energy throughout thee collision.
Answer:
qwertyuiopasdfghjkl;Zxcvbnm,zxfbfa
Explanation:
