Oil is more dense than alcohol, but less dense than water. The molecules that make up the oil are larger than those that that make up water, so they cannot pack as tightly together as the water molecules can. They take up more space per unit area and are less dense.
Answer:
The correct answer is - sulfur.
Explanation:
In the periodic table, there are 18 groups and 7 rows or periods arranged according to their atomic number or electronic configuration. In the question, it is mentioned that the desired element atomic mass is less than the atomic mass of the selenium which is 78.96, and more than oxygen which is 15.99 with 6 electron valence and present in the third row.
As it has 6 valency of electron it must be in the 16 group of the table that comprises the 6 valency and as it is located in the 3rd row it must be sulfur that also has an atomic mass between selenium and oxygen.
Answer:
20.3 kJ of heat is absorbed when 9.00 g of steam condenses to liquid water.
Explanation:
Heat is being consumed during vaporization and heat is being released during condensation.
To vaporize 1 mol of water, 40.66 kJ of heat is being consumed.
Molar mass of water = 18.02 g/mol
Hence, to vaporize 18.02 g of water , 40.66 kJ of heat is being consumed.
So, to vaporize 9.00 g of water, 
of heat or 20.3 kJ of heat is being consumed
As condensation is a reverse process of vaporization therefore 20.3 kJ of heat is absorbed when 9.00 g of steam condenses to liquid water.
What class is this? (Subject)
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
