Answer:
A scale, or a weight. Both of which are more scientifically referred to as a balance.
The volume of a gas that its pressure increase to 3.4 atm is calculated as follows
By use of boyles law that is P1V1=P2V2
V1=4.0 L
P1=1.1 atm
P2=3.4 atm
V2= P1V1/P2
(1.1 atm x 4.0 L)/3.4 atm= 1.29 L
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
Reaction of dissociation: Ag₂SO₄ → 2Ag⁺ + SO₄²⁻.
m(Ag₂SO₄) = 4 g.
V(Ag₂SO₄) = 1 l.
n(Ag₂SO₄) = m(Ag₂SO₄) ÷ M(Ag₂SO₄).
n(Ag₂SO₄) = 4 g ÷ 311,8 g/mol.
n(Ag₂SO₄) = 0,0128 mol.
n(Ag⁺) = 2 · 0,0128 mol = 0,0256 mol.
n(Ag₂SO₄) = n(SO₄²⁻) = 0,0128 mol.
c(Ag⁺) = n ÷ V = 0,0256 mol ÷ 1 l = 0,0256 mol/l.
Ksp = c(Ag⁺)² · c(SO₄²⁻).
Ksp = (0,0256 mol/l)² · 0,0128 mol/l.
Ksp = 8,3·10⁻⁶.
Answer:
4.419 g
Explanation:
55 years is 5.5 half lives
200 g * (1/2)^5.5 = 4.419 g