The answer is D. To put it simply, all atom wished to become stable. The only way for that is to obtain an octet structure where the outermost shell would have 8 electrons, thus being full.
Answer:
Red
Explanation:
Red color is evidenced when thymol blue indicator is in a solution having a pH of 11. A pH of 11 means that the solution is basic or alkaline. Therefore, the indicator turns red, indicating that the solution is alkaline.
When thymol blue indicator is in a acidic solution, the indicator remains blue.
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
From the calculations, the concentration of the acid is 0.24 M.
<h3>What is neutralization?</h3>
The term neutralization has to do with a reaction in which an acid and a base react to form salt and water only.
We have to use the formula;
CAVA/CBVB = NA/NB
CAVANB =CBVBNA
The equation of the reaction is; 2NaOH + H2SO4 ----> Na2SO4 + 2H2O
CA = ?
CB = 1.2 M
VA = 50 mL
VB = 20 mL
NA = 1
NB = 2
CA = CBVBNA/VANB
CA = 1.2 M * 20 mL * 1/ 50 mL * 2
CA = 0.24 M
Learn more about neutralization:brainly.com/question/27891712
#SPJ1
