Answer:
negative, positive, increase
Explanation:
From the given question,
During the formation of bond, between two atoms with difference between their electronegativity-
- The more electronegative atom, will pull the electrons towards itself , and hence acquires a partial negative charge,
And,
- The less electronegative atom, will acquire a partial positive charge.
- The more the difference between the electronegativity of the atoms, the more would be the magnitude of partial charge.
- And, the less would be the difference between the electronegativity of the atoms, the lesser would be the magnitude of partial charge.
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
Explanation:
how are you confused there just tell me the problem
Answer:
https://youtu.be/3zmeVamEsWI
Explanation:
It is defined as the ratio of moles of one substance to the moles of another substance in a balanced equation. ... Mole ratios are the central step in performing stoichiometry because they allow us to convert moles of one substance to moles of another substance.
The scientific models are used because they allow scientists to make predictions and make it easier for scientists to avoid using data. option A and C is correct.
<h3>What are scientific models?</h3>
The scientific models are those which is given by scientists to allow them to make prediction about anything particular on which they are working or making research for it some examples are plum pudding model for an atom and bohr's model of an atom etc.
The biggest advantage is that scientists do not have to check the given data which are written into books they can perform their experiment and can conclude the data by performing experiment.
Therefore, scientific models are used because they allow scientists to make predictions and make it easier for scientists to avoid using data. option A and C is correct.
Learn more about scientific models, here:
brainly.com/question/1622233
#SPJ1
