Answer: Molecules or substances that have tendency to donate electrons
Explanation:
The answer is natural gasses
1 part per million is the same as
<span>1 mcg/mL (mcg = 1 micro gram = 1 * 10^-6 grams). </span>
<span>125 ppm = 125 mcg/mL </span>
<span>125 mcg/ml * [1 gram / 1 * 10^6 mgrm] = 1.25 * 10^-4 grams </span>
<span>The density of hard water is 1.000 grams / mL </span>
<span>50 mL of water contains 1.25 * 10^-4 grams. </span>
<span>given mass = 1.25 * 10^-4 </span>
<span>Molar mass = 100.0 grams / mole </span>
<span>n = ????? </span>
<span>n = 1.25 * 10^-4/100 = 1.25 * 10^-6 moles.
Thank you for posting your question here at brainly. I hope the answer will help you. Feel free to ask more questions.
</span>
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer:
72.6 grams
Explanation:
I got this answer through stoichiometry. For every 1 mole of Mg, 2 moles of CuBr are consumed. Because of this, multiply the moles of Mg by 2. Then, convert moles to grams.
