The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Sodium chloride is made from one sodium atom and one chlorine atom:
Sodium has a charge of +1, or just +.
Chlorine has a charge of -1, or just -.
These balance out.
Answer:
(we use hess's law) it is so simple but the second reaction is not correct please right it
The answer according to my teacher would be Supersaturated
