Answer:
First you have to separate real and imaginary parts of Tan(x+iy)=Tan(z)=sin(z)/cos(z)
sinz=sin(x+iy)=sinxcos(iy)+cosxsin(iy)=sinxcoshy-icosx sinhy
cosz=cos(x+iy)=cosxcos(iy)-sinxsin(iy)=cosxcoshy−isinxsinhy
Now if you plug in Tan(z) and simplify (it is easy!) you get
Tan(z)=(sin(2x)+isinh(2y))/(cos(2x)+cosh(2y))= A+iB.
This means that
A=sin(2x)/(cos(2x)+cosh(2y)) and B= sinh(2y)/(cos(2x)+cosh(2y))
Now,
A/B=sin(2x)/sinh(2y)
If any questions, let me know.
Answer:
a)temperature=69.1C
b)3054Kw
Explanation:
Hello!
To solve this problem follow the steps below, the complete procedure is in the attached image
1. draw a complete outline of the problem
2. to find the temperature at the turbine exit use termodinamic tables to find the saturation temperature at 30kPa
note=Through laboratory tests, thermodynamic tables were developed, these allow to know all the thermodynamic properties of a substance (entropy, enthalpy, pressure, specific volume, internal energy etc ..)
through prior knowledge of two other properties such as pressure and temperature.
3. Using thermodynamic tables find the enthalpy and entropy at the turbine inlet, then find the ideal enthalpy using the entropy of state 1 and the outlet pressure = 30kPa
4. The efficiency of the turbine is defined as the ratio between the real power and the ideal power, with this we find the real enthalpy.
Note: Remember that for a turbine with a single input and output, the power is calculated as the product of the mass flow and the difference in enthalpies.
5. Find the real power of the turbine
Explanation:
Conduction:
Heat transfer in the conduction occurs due to movement of molecule or we can say that due to movement of electrons in the two end of same the body. Generally, phenomenon of conduction happens in the case of solid . In conduction heat transfer takes places due to direct contact of two bodies.
Convection:
In convection heat transfer of fluid takes place due to density difference .In simple words we can say that heat transfer occur due to motion of fluid.
Answer:
hope this helps
Explanation:
answers:
1. Chemical engineering is most difficult because it's a mix of physics, chemistry and math
2. Stoichiometry is so important because it shows how materials react, interact and play off each other
3. Yes I think consumers would notice if process control standards were not met. for example medicines, when people take Tylenol or cold pills, if the amount of time it took to kick it becomes longer, people will become aware that the product is not consistent and reliable.
4. i have no idea sorry :(
5. This is explaining how there are rules and regulations to make the workplace safe. it can be accomplished by following those rules and regulations