The answer is d Thus, the first energy level holds 2 * 1^2 = 2 electrons, while the second holds 2 * 2^2 = 8 electrons. Each orbital. The third energy level can hold up to 18 electrons, meaning that it is not full when it has only electrons.
Answer:
a) 1.866 × 10 ⁻¹⁹ J b) 3.685 × 10⁻¹⁹ J
Explanation:
the constants involved are
h ( Planck constant) = 6.626 × 10⁻³⁴ m² kg/s
Me of electron = 9.109 × 10 ⁻³¹ kg
speed of light = 3.0 × 10 ⁸ m/s
a) the Ek ( kinetic energy of the dislodged electron) = 0.5 mu²
Ek = 0.5 × 9.109 × 10⁻³¹ × ( 6.40 × 10⁵ )² = 1.866 × 10 ⁻¹⁹ J
b) Φ ( minimum energy needed to dislodge the electron ) can be calculated by this formula
hv = Φ + Ek
where Ek = 1.866 × 10 ⁻¹⁹ J
v ( threshold frequency ) = c / λ where c is the speed of light and λ is the wavelength of light = 358.1 nm = 3.581 × 10⁻⁷ m
v = ( 3.0 × 10 ⁸ m/s ) / (3.581 × 10⁻⁷ m ) = 8.378 × 10¹⁴ s⁻¹
hv = 6.626 × 10⁻³⁴ m² kg/s × 8.378 × 10¹⁴ s⁻¹ = 5.551 × 10⁻¹⁹ J
5.551 × 10⁻¹⁹ J = 1.866 × 10 ⁻¹⁹ J + Φ
Φ = 5.551 × 10⁻¹⁹ J - 1.866 × 10 ⁻¹⁹ J = 3.685 × 10⁻¹⁹ J
Answer:
Always carry the microscope with two hands. One on the arm and one underneath the base of the microscope.
Hello)
1)CH3-CH(OH)-СН2-СН2-СН2-СН2-СН3---(H2SO4)--›CH3-CH=CH-CH2-CH2-CH2-CH3+H2O
2)2-methyl-l-cyclohexanol---(h2so4)--›CH2=C(CH3)-CH2-CH2-CH2-CH2-CH3+H2O
Answer:
Experiment you will be able to watch a chemical reaction. In this experiment vinegar (a substance) and baking soda (a substance) will mix together. When mixed together the molecules of the two substances will re-arrange, or change, to make new substances.
Vinegar has acetic acid in it. The chemical name for baking soda is sodium bicarbonate. When you mix the two together you get sodium acetate and water. You also get carbon dioxide, which is a gas. The bag puffs up because carbon dioxide is a gas and takes up a lot of space. Eventually the bag isn't big enough to hold all that carbon dioxide gas so it explodes!
Explanation:
hope it helps ig! :\