Mass percent= grams solute/ grams of solution x 100
Mass Percent= (50/ 150)x100= 33.3%
Answer:
<span> Its location is in the nucleus, because the particle is a proton or a neutron.</span>
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer:
They are due to past earthquakes
440 cause mass cant be created or destroyed