Answer:
ya same here i hope so btw
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer:
Frequency = 6.16 ×10¹⁴ Hz
λ = 4.87×10² nm
Explanation:
In case of hydrogen atom energy associated with nth state is,
En = -13.6/n²
For n = 2
E₂ = -13.6 / 2²
E₂ = -13.6/4
E₂ = -3.4 ev
Kinetic energy of electron = -E₂ = 3.4 ev
For n = 4
E₄ = -13.6 / 4²
E₄ = -13.6/16
E₄ = -0.85 ev
Kinetic energy of electron = -E₄ = 0.85 ev
Wavelength of radiation emitted:
E = hc/λ = E₄ - E₂
hc/λ = E₄ - E₂
by putting values,
6.63×10⁻³⁴Js × 3×10⁸m/s / λ = -0.85ev - (-3.4ev )
6.63×10⁻³⁴ Js× 3×10⁸m/s / λ = 2.55 ev
λ = 6.63×10⁻³⁴ Js× 3×10⁸m/s /2.55ev
λ = 6.63×10⁻³⁴ Js× 3×10⁸m/s /2.55× 1.6×10⁻¹⁹ J
λ = 19.89 ×10⁻²⁶ Jm / 2.55× 1.6×10⁻¹⁹ J
λ = 19.89 ×10⁻²⁶ Jm / 4.08×10⁻¹⁹ J
λ = 4.87×10⁻⁷ m
m to nm:
4.87×10⁻⁷ m ×10⁹nm/1 m
4.87×10² nm
Frequency:
Frequency = speed of electron / wavelength
by putting values,
Frequency = 3×10⁸m/s /4.87×10⁻⁷ m
Frequency = 6.16 ×10¹⁴ s⁻¹
s⁻¹ = Hz
Frequency = 6.16 ×10¹⁴ Hz
Answer:
the symbol that is missing might be 2.
Explanation:
I am not 100% on this, so correct me if I am wrong.
Yes a red blood cell placed in a sline solution shrinks because of the process of osmosis.
